C27H21ClN2O4 — CID 4307836
[4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate (PubChem CID 4307836) has the molecular formula C27H21ClN2O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4307836 |
| Molecular Formula | C27H21ClN2O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)N2CCc3ccccc32)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C27H21ClN2O4/c1-2-33-25-16-18(11-12-24(25)34-27(32)21-8-4-5-9-22(21)28)15-20(17-29)26(31)30-14-13-19-7-3-6-10-23(19)30/h3-12,15-16H,2,13-14H2,1H3 |
| InChIKey | BTKCAFOCCLJKCM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|