C27H21N3O6 — CID 4647235
[4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-nitrobenzoate (PubChem CID 4647235) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-nitrobenzoate.
| Compound Name | [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 4647235 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [4-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-nitrobenzoate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)N2CCc3ccccc32)ccc1OC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H21N3O6/c1-2-35-25-15-18(10-11-24(25)36-27(32)20-7-5-8-22(16-20)30(33)34)14-21(17-28)26(31)29-13-12-19-6-3-4-9-23(19)29/h3-11,14-16H,2,12-13H2,1H3 |
| InChIKey | RGAMVLIGKYSSBQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 122.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|