C27H23ClN2O4 — CID 3385178
3-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile (PubChem CID 3385178) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is 3-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3385178 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 3-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)C(=O)N2CCc3ccccc32)ccc1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C27H23ClN2O4/c1-32-26-17-19(10-11-25(26)34-15-14-33-24-9-5-3-7-22(24)28)16-21(18-29)27(31)30-13-12-20-6-2-4-8-23(20)30/h2-11,16-17H,12-15H2,1H3 |
| InChIKey | SAHFGIKAOUYMOV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|