C17H14FNO2 — CID 4210585
3-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 4210585) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 3-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4210585 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=CC#N)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C17H14FNO2/c1-20-17-11-13(5-4-10-19)8-9-16(17)21-12-14-6-2-3-7-15(14)18/h2-9,11H,12H2,1H3 |
| InChIKey | WGGJLZRZVWSGFY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|