C18H15ClFNO2 — CID 3588353
3-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 3588353) has the molecular formula C18H15ClFNO2 and a molecular weight of 331.77 g/mol. Its IUPAC name is 3-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 3-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3588353 |
| Molecular Formula | C18H15ClFNO2 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(C=CC#N)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C18H15ClFNO2/c1-2-22-17-11-13(6-5-9-21)10-15(19)18(17)23-12-14-7-3-4-8-16(14)20/h3-8,10-11H,2,12H2,1H3 |
| InChIKey | DPSOGGUPKRROCU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|