C25H20Cl2N2O3 — CID 3515294
4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 3515294) has the molecular formula C25H20Cl2N2O3 and a molecular weight of 467.35 g/mol. Its IUPAC name is 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3515294 |
| Molecular Formula | C25H20Cl2N2O3 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)N=C2C)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H20Cl2N2O3/c1-16-20(25(30)29(28-16)19-6-4-3-5-7-19)12-17-9-11-23(24(14-17)31-2)32-15-18-8-10-21(26)22(27)13-18/h3-14H,15H2,1-2H3 |
| InChIKey | AUTMOVSNKSXAGT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|