C27H26N2O3 — CID 6163352
(4Z)-2-(3,4-dimethylphenyl)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 6163352) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is (4Z)-2-(3,4-dimethylphenyl)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(3,4-dimethylphenyl)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 6163352 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (4Z)-2-(3,4-dimethylphenyl)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccc(C)c(C)c3)N=C2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H26N2O3/c1-18-10-12-23(14-19(18)2)29-27(30)24(20(3)28-29)15-22-11-13-25(26(16-22)31-4)32-17-21-8-6-5-7-9-21/h5-16H,17H2,1-4H3/b24-15- |
| InChIKey | RCMYFHYALKEBPV-IWIPYMOSSA-N |
| XLogP | 5.70 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|