C23H25ClN2O3 — CID 21214181
(4E)-2-(4-chlorophenyl)-4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-5-methylpyrazol-3-one (PubChem CID 21214181) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (4E)-2-(4-chlorophenyl)-4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(4-chlorophenyl)-4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 21214181 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (4E)-2-(4-chlorophenyl)-4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-5-methylpyrazol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccc(Cl)cc3)N=C2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C23H25ClN2O3/c1-15(2)11-12-29-21-10-5-17(14-22(21)28-4)13-20-16(3)25-26(23(20)27)19-8-6-18(24)7-9-19/h5-10,13-15H,11-12H2,1-4H3/b20-13+ |
| InChIKey | MGWWMOROGWRCKM-DEDYPNTBSA-N |
| XLogP | 5.58 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|