C24H26N3O2S+ — CID 3663053
[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3663053) has the molecular formula C24H26N3O2S+ and a molecular weight of 420.56 g/mol. Its IUPAC name is [3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | [3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3663053 |
| Molecular Formula | C24H26N3O2S+ |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | CCOc1cc(C=[NH+]NC(=S)Nc2ccccc2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C24H25N3O2S/c1-3-28-23-15-19(16-25-27-24(30)26-21-11-5-4-6-12-21)13-14-22(23)29-17-20-10-8-7-9-18(20)2/h4-16H,3,17H2,1-2H3,(H2,26,27,30)/p+1 |
| InChIKey | GCOUMLSUXPKAAF-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|