C22H22N3OS+ — CID 3568111
[2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3568111) has the molecular formula C22H22N3OS+ and a molecular weight of 376.51 g/mol. Its IUPAC name is [2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | [2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3568111 |
| Molecular Formula | C22H22N3OS+ |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | Cc1ccccc1COc1ccccc1C=[NH+]NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C22H21N3OS/c1-17-9-5-6-11-19(17)16-26-21-14-8-7-10-18(21)15-23-25-22(27)24-20-12-3-2-4-13-20/h2-15H,16H2,1H3,(H2,24,25,27)/p+1 |
| InChIKey | VPYKGOWEUZENAE-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|