C15H15BrN3O2S+ — CID 3663072
(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3663072) has the molecular formula C15H15BrN3O2S+ and a molecular weight of 381.28 g/mol. Its IUPAC name is (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3663072 |
| Molecular Formula | C15H15BrN3O2S+ |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | COc1cc(Br)cc(C=[NH+]NC(=S)Nc2ccccc2)c1O |
| InChI | InChI=1S/C15H14BrN3O2S/c1-21-13-8-11(16)7-10(14(13)20)9-17-19-15(22)18-12-5-3-2-4-6-12/h2-9,20H,1H3,(H2,18,19,22)/p+1 |
| InChIKey | DYJYZJWQAJGFTB-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|