C14H14N3OS+ — CID 3652022
(2-hydroxyphenyl)methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3652022) has the molecular formula C14H14N3OS+ and a molecular weight of 272.35 g/mol. Its IUPAC name is (2-hydroxyphenyl)methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | (2-hydroxyphenyl)methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3652022 |
| Molecular Formula | C14H14N3OS+ |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2-hydroxyphenyl)methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | Oc1ccccc1C=[NH+]NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H13N3OS/c18-13-9-5-4-6-11(13)10-15-17-14(19)16-12-7-2-1-3-8-12/h1-10,18H,(H2,16,17,19)/p+1 |
| InChIKey | BKJAPBJJTOJXEZ-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|