C20H20N3OS+ — CID 5055045
(2-ethoxynaphthalen-1-yl)methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 5055045) has the molecular formula C20H20N3OS+ and a molecular weight of 350.47 g/mol. Its IUPAC name is (2-ethoxynaphthalen-1-yl)methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | (2-ethoxynaphthalen-1-yl)methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 5055045 |
| Molecular Formula | C20H20N3OS+ |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2-ethoxynaphthalen-1-yl)methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | CCOc1ccc2ccccc2c1C=[NH+]NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3OS/c1-2-24-19-13-12-15-8-6-7-11-17(15)18(19)14-21-23-20(25)22-16-9-4-3-5-10-16/h3-14H,2H2,1H3,(H2,22,23,25)/p+1 |
| InChIKey | DOQINQFVBNYSPG-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|