C23H24N3O2S+ — CID 3679852
[3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3679852) has the molecular formula C23H24N3O2S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is [3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | [3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3679852 |
| Molecular Formula | C23H24N3O2S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | COc1cccc(C=[NH+]NC(=S)Nc2ccccc2)c1OCc1ccccc1C |
| InChI | InChI=1S/C23H23N3O2S/c1-17-9-6-7-10-19(17)16-28-22-18(11-8-14-21(22)27-2)15-24-26-23(29)25-20-12-4-3-5-13-20/h3-15H,16H2,1-2H3,(H2,25,26,29)/p+1 |
| InChIKey | YRCZQQBGBIZGJX-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|