C17H20N3OS+ — CID 4164230
(methylcarbamothioylamino)-[[2-[(2-methylphenyl)methoxy]phenyl]methylidene]azanium (PubChem CID 4164230) has the molecular formula C17H20N3OS+ and a molecular weight of 314.43 g/mol. Its IUPAC name is (methylcarbamothioylamino)-[[2-[(2-methylphenyl)methoxy]phenyl]methylidene]azanium.
| Compound Name | (methylcarbamothioylamino)-[[2-[(2-methylphenyl)methoxy]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 4164230 |
| Molecular Formula | C17H20N3OS+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (methylcarbamothioylamino)-[[2-[(2-methylphenyl)methoxy]phenyl]methylidene]azanium |
| SMILES | CNC(=S)N[NH+]=Cc1ccccc1OCc1ccccc1C |
| InChI | InChI=1S/C17H19N3OS/c1-13-7-3-4-9-15(13)12-21-16-10-6-5-8-14(16)11-19-20-17(22)18-2/h3-11H,12H2,1-2H3,(H2,18,20,22)/p+1 |
| InChIKey | OOWNHTHLZLXVKU-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|