C16H17ClN3OS+ — CID 4159500
[2-[(4-chlorophenyl)methoxy]phenyl]methylidene-(methylcarbamothioylamino)azanium (PubChem CID 4159500) has the molecular formula C16H17ClN3OS+ and a molecular weight of 334.85 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methoxy]phenyl]methylidene-(methylcarbamothioylamino)azanium.
| Compound Name | [2-[(4-chlorophenyl)methoxy]phenyl]methylidene-(methylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 4159500 |
| Molecular Formula | C16H17ClN3OS+ |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2-[(4-chlorophenyl)methoxy]phenyl]methylidene-(methylcarbamothioylamino)azanium |
| SMILES | CNC(=S)N[NH+]=Cc1ccccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-18-16(22)20-19-10-13-4-2-3-5-15(13)21-11-12-6-8-14(17)9-7-12/h2-10H,11H2,1H3,(H2,18,20,22)/p+1 |
| InChIKey | AXZUTYXHDZMZBF-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|