C11H15BrN3O2S+ — CID 5211818
(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(ethylcarbamothioylamino)azanium (PubChem CID 5211818) has the molecular formula C11H15BrN3O2S+ and a molecular weight of 333.23 g/mol. Its IUPAC name is (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(ethylcarbamothioylamino)azanium.
| Compound Name | (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 5211818 |
| Molecular Formula | C11H15BrN3O2S+ |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (5-bromo-2-hydroxy-3-methoxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
| SMILES | CCNC(=S)N[NH+]=Cc1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C11H14BrN3O2S/c1-3-13-11(18)15-14-6-7-4-8(12)5-9(17-2)10(7)16/h4-6,16H,3H2,1-2H3,(H2,13,15,18)/p+1 |
| InChIKey | PJSVRWDXEZRSFJ-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|