C12H18N3O3S+ — CID 3463502
(methylcarbamothioylamino)-[(2,4,5-trimethoxyphenyl)methylidene]azanium (PubChem CID 3463502) has the molecular formula C12H18N3O3S+ and a molecular weight of 284.36 g/mol. Its IUPAC name is (methylcarbamothioylamino)-[(2,4,5-trimethoxyphenyl)methylidene]azanium.
| Compound Name | (methylcarbamothioylamino)-[(2,4,5-trimethoxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 3463502 |
| Molecular Formula | C12H18N3O3S+ |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (methylcarbamothioylamino)-[(2,4,5-trimethoxyphenyl)methylidene]azanium |
| SMILES | CNC(=S)N[NH+]=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H17N3O3S/c1-13-12(19)15-14-7-8-5-10(17-3)11(18-4)6-9(8)16-2/h5-7H,1-4H3,(H2,13,15,19)/p+1 |
| InChIKey | WJDWDTYDKRAPCO-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|