C9H9Cl3N3S+ — CID 4255768
(methylcarbamothioylamino)-[(2,3,6-trichlorophenyl)methylidene]azanium (PubChem CID 4255768) has the molecular formula C9H9Cl3N3S+ and a molecular weight of 297.62 g/mol. Its IUPAC name is (methylcarbamothioylamino)-[(2,3,6-trichlorophenyl)methylidene]azanium.
| Compound Name | (methylcarbamothioylamino)-[(2,3,6-trichlorophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 4255768 |
| Molecular Formula | C9H9Cl3N3S+ |
| Molecular Weight | 297.62 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | (methylcarbamothioylamino)-[(2,3,6-trichlorophenyl)methylidene]azanium |
| SMILES | CNC(=S)N[NH+]=Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3N3S/c1-13-9(16)15-14-4-5-6(10)2-3-7(11)8(5)12/h2-4H,1H3,(H2,13,15,16)/p+1 |
| InChIKey | IFFJQTOGVCOLBL-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|