About (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine
(2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine (PubChem CID 79322402) has the molecular formula C11H12Cl3N
and a molecular weight of 264.58 g/mol. Its IUPAC name is (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine.
Molecular Properties
| Compound Name | (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine |
| PubChem CID | 79322402 |
| Molecular Formula | C11H12Cl3N |
| Molecular Weight | 264.58 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine |
| SMILES | CC/C(=C/c1c(Cl)ccc(Cl)c1Cl)CN |
| InChI | InChI=1S/C11H12Cl3N/c1-2-7(6-15)5-8-9(12)3-4-10(13)11(8)14/h3-5H,2,6,15H2,1H3/b7-5- |
| InChIKey | ZJZBVZGNNSCDMF-ALCCZGGFSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine?
The IUPAC name of (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine (CID 79322402) is (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine.
What is the SMILES notation for (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine?
The canonical SMILES for (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine is CC/C(=C/c1c(Cl)ccc(Cl)c1Cl)CN.
What is the InChIKey of (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine?
The InChIKey is ZJZBVZGNNSCDMF-ALCCZGGFSA-N. The full InChI is InChI=1S/C11H12Cl3N/c1-2-7(6-15)5-8-9(12)3-4-10(13)11(8)14/h3-5H,2,6,15H2,1H3/b7-5-.
What are the key properties of (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine?
(2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine has a molecular weight of 264.58 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine is sourced from PubChem (CID 79322402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).