C11H12Cl3N — CID 79322402
(2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine (PubChem CID 79322402) has the molecular formula C11H12Cl3N and a molecular weight of 264.58 g/mol. Its IUPAC name is (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine.
| Compound Name | (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine |
|---|---|
| PubChem CID | 79322402 |
| Molecular Formula | C11H12Cl3N |
| Molecular Weight | 264.58 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | (2Z)-2-[(2,3,6-trichlorophenyl)methylidene]butan-1-amine |
| SMILES | CC/C(=C/c1c(Cl)ccc(Cl)c1Cl)CN |
| InChI | InChI=1S/C11H12Cl3N/c1-2-7(6-15)5-8-9(12)3-4-10(13)11(8)14/h3-5H,2,6,15H2,1H3/b7-5- |
| InChIKey | ZJZBVZGNNSCDMF-ALCCZGGFSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|