C9H11Cl4N — CID 3041172
1-(2,4,5-trichlorophenyl)propan-2-amine;hydrochloride (PubChem CID 3041172) has the molecular formula C9H11Cl4N and a molecular weight of 275.01 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)propan-2-amine;hydrochloride.
| Compound Name | 1-(2,4,5-trichlorophenyl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 3041172 |
| Molecular Formula | C9H11Cl4N |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)propan-2-amine;hydrochloride |
| SMILES | CC(N)Cc1cc(Cl)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C9H10Cl3N.ClH/c1-5(13)2-6-3-8(11)9(12)4-7(6)10;/h3-5H,2,13H2,1H3;1H |
| InChIKey | IFTAPAZHHOGGQQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|