C9H10ClF2NO — CID 117317248
4-(2-aminopropyl)-6-chloro-2,3-difluorophenol (PubChem CID 117317248) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is 4-(2-aminopropyl)-6-chloro-2,3-difluorophenol.
| Compound Name | 4-(2-aminopropyl)-6-chloro-2,3-difluorophenol |
|---|---|
| PubChem CID | 117317248 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 4-(2-aminopropyl)-6-chloro-2,3-difluorophenol |
| SMILES | CC(N)Cc1cc(Cl)c(O)c(F)c1F |
| InChI | InChI=1S/C9H10ClF2NO/c1-4(13)2-5-3-6(10)9(14)8(12)7(5)11/h3-4,14H,2,13H2,1H3 |
| InChIKey | DKLBQHHGVMHAIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|