C8H7ClF2O2 — CID 117298062
6-chloro-2,3-difluoro-4-(1-hydroxyethyl)phenol (PubChem CID 117298062) has the molecular formula C8H7ClF2O2 and a molecular weight of 208.59 g/mol. Its IUPAC name is 6-chloro-2,3-difluoro-4-(1-hydroxyethyl)phenol.
| Compound Name | 6-chloro-2,3-difluoro-4-(1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 117298062 |
| Molecular Formula | C8H7ClF2O2 |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 6-chloro-2,3-difluoro-4-(1-hydroxyethyl)phenol |
| SMILES | CC(O)c1cc(Cl)c(O)c(F)c1F |
| InChI | InChI=1S/C8H7ClF2O2/c1-3(12)4-2-5(9)8(13)7(11)6(4)10/h2-3,12-13H,1H3 |
| InChIKey | CQAZFKDDEAJLET-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|