C10H12Br2N3OS+ — CID 4069599
(3,5-dibromo-2-hydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium (PubChem CID 4069599) has the molecular formula C10H12Br2N3OS+ and a molecular weight of 382.10 g/mol. Its IUPAC name is (3,5-dibromo-2-hydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium.
| Compound Name | (3,5-dibromo-2-hydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 4069599 |
| Molecular Formula | C10H12Br2N3OS+ |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | (3,5-dibromo-2-hydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
| SMILES | CCNC(=S)N[NH+]=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C10H11Br2N3OS/c1-2-13-10(17)15-14-5-6-3-7(11)4-8(12)9(6)16/h3-5,16H,2H2,1H3,(H2,13,15,17)/p+1 |
| InChIKey | PZLNDRPABDGZQI-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|