C10H13N4O3S+ — CID 5211821
(ethylcarbamothioylamino)-[(2-hydroxy-5-nitrophenyl)methylidene]azanium (PubChem CID 5211821) has the molecular formula C10H13N4O3S+ and a molecular weight of 269.31 g/mol. Its IUPAC name is (ethylcarbamothioylamino)-[(2-hydroxy-5-nitrophenyl)methylidene]azanium.
| Compound Name | (ethylcarbamothioylamino)-[(2-hydroxy-5-nitrophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 5211821 |
| Molecular Formula | C10H13N4O3S+ |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (ethylcarbamothioylamino)-[(2-hydroxy-5-nitrophenyl)methylidene]azanium |
| SMILES | CCNC(=S)N[NH+]=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C10H12N4O3S/c1-2-11-10(18)13-12-6-7-5-8(14(16)17)3-4-9(7)15/h3-6,15H,2H2,1H3,(H2,11,13,18)/p+1 |
| InChIKey | RBMLXWGQAMURNK-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|