C13H16N4O6S — CID 135499230
2-[[[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]carbamothioylamino]methoxy]ethyl acetate (PubChem CID 135499230) has the molecular formula C13H16N4O6S and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-[[[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]carbamothioylamino]methoxy]ethyl acetate.
| Compound Name | 2-[[[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]carbamothioylamino]methoxy]ethyl acetate |
|---|---|
| PubChem CID | 135499230 |
| Molecular Formula | C13H16N4O6S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[[[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]carbamothioylamino]methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCNC(=S)N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C13H16N4O6S/c1-9(18)23-5-4-22-8-14-13(24)16-15-7-10-6-11(17(20)21)2-3-12(10)19/h2-3,6-7,19H,4-5,8H2,1H3,(H2,14,16,24)/b15-7+ |
| InChIKey | UWDFAODCUKGBFG-VIZOYTHASA-N |
| XLogP | 0.64 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|