C10H14N3O2S+ — CID 162678578
(E)-(3,4-dihydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium (PubChem CID 162678578) has the molecular formula C10H14N3O2S+ and a molecular weight of 240.31 g/mol. Its IUPAC name is (E)-(3,4-dihydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium.
| Compound Name | (E)-(3,4-dihydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 162678578 |
| Molecular Formula | C10H14N3O2S+ |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (E)-(3,4-dihydroxyphenyl)methylidene-(ethylcarbamothioylamino)azanium |
| SMILES | CCNC(=S)N/[NH+]=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13N3O2S/c1-2-11-10(16)13-12-6-7-3-4-8(14)9(15)5-7/h3-6,14-15H,2H2,1H3,(H2,11,13,16)/p+1/b12-6+ |
| InChIKey | WJWMULSSSFEIJZ-WUXMJOGZSA-O |
| XLogP | -1.00 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|