About (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide
(Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide (PubChem CID 177341664) has the molecular formula C12H12N2O2S
and a molecular weight of 248.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide.
Molecular Properties
| Compound Name | (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide |
| PubChem CID | 177341664 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide |
| SMILES | CCNC(=S)/C(C#N)=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H12N2O2S/c1-2-14-12(17)9(7-13)5-8-3-4-10(15)11(16)6-8/h3-6,15-16H,2H2,1H3,(H,14,17)/b9-5- |
| InChIKey | RHEAQRFUWRBHAK-UITAMQMPSA-N |
| XLogP | 1.94 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide?
The IUPAC name of (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide (CID 177341664) is (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide.
What is the SMILES notation for (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide?
The canonical SMILES for (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide is CCNC(=S)/C(C#N)=C\c1ccc(O)c(O)c1.
What is the InChIKey of (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide?
The InChIKey is RHEAQRFUWRBHAK-UITAMQMPSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-2-14-12(17)9(7-13)5-8-3-4-10(15)11(16)6-8/h3-6,15-16H,2H2,1H3,(H,14,17)/b9-5-.
What are the key properties of (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide?
(Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide has a molecular weight of 248.31 g/mol, XLogP of 1.94, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-cyano-3-(3,4-dihydroxyphenyl)-N-ethylprop-2-enethioamide is sourced from PubChem (CID 177341664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).