C19H17NO4 — CID 67830676
1-phenylpropyl 2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 67830676) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-phenylpropyl 2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 1-phenylpropyl 2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67830676 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-phenylpropyl 2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCC(OC(=O)C(C#N)=Cc1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C19H17NO4/c1-2-18(14-6-4-3-5-7-14)24-19(23)15(12-20)10-13-8-9-16(21)17(22)11-13/h3-11,18,21-22H,2H2,1H3 |
| InChIKey | SBIKOZQFEMVBDW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|