C15H15NO5 — CID 139578090
5-[(E)-2-cyano-3-(2-methylpropoxy)-3-oxoprop-1-enyl]-2-hydroxybenzoic acid (PubChem CID 139578090) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[(E)-2-cyano-3-(2-methylpropoxy)-3-oxoprop-1-enyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(E)-2-cyano-3-(2-methylpropoxy)-3-oxoprop-1-enyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139578090 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-[(E)-2-cyano-3-(2-methylpropoxy)-3-oxoprop-1-enyl]-2-hydroxybenzoic acid |
| SMILES | CC(C)COC(=O)/C(C#N)=C/c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H15NO5/c1-9(2)8-21-15(20)11(7-16)5-10-3-4-13(17)12(6-10)14(18)19/h3-6,9,17H,8H2,1-2H3,(H,18,19)/b11-5+ |
| InChIKey | ACBCAXFKOGDHQR-VZUCSPMQSA-N |
| XLogP | 2.20 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|