C12H15BrN3O2S+ — CID 135615689
(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium (PubChem CID 135615689) has the molecular formula C12H15BrN3O2S+ and a molecular weight of 345.24 g/mol. Its IUPAC name is (E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium.
| Compound Name | (E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 135615689 |
| Molecular Formula | C12H15BrN3O2S+ |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium |
| SMILES | C=CCNC(=S)N/[NH+]=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C12H14BrN3O2S/c1-3-4-14-12(19)16-15-7-8-5-9(13)11(17)10(6-8)18-2/h3,5-7,17H,1,4H2,2H3,(H2,14,16,19)/p+1/b15-7+ |
| InChIKey | CAAHWNCPXOWYLT-VIZOYTHASA-O |
| XLogP | 0.23 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|