C18H18Cl3N3O2S — CID 4081572
1-ethyl-3-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 4081572) has the molecular formula C18H18Cl3N3O2S and a molecular weight of 446.79 g/mol. Its IUPAC name is 1-ethyl-3-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | 1-ethyl-3-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 4081572 |
| Molecular Formula | C18H18Cl3N3O2S |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-ethyl-3-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | CCNC(=S)NN=Cc1ccc(OCc2c(Cl)ccc(Cl)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H18Cl3N3O2S/c1-3-22-18(27)24-23-9-11-4-7-15(16(8-11)25-2)26-10-12-13(19)5-6-14(20)17(12)21/h4-9H,3,10H2,1-2H3,(H2,22,24,27) |
| InChIKey | PASQXNYMKAZVPV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|