C17H17ClFN3OS — CID 6257139
1-[(Z)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 6257139) has the molecular formula C17H17ClFN3OS and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-[(Z)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 6257139 |
| Molecular Formula | C17H17ClFN3OS |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-[(Z)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1ccc(OCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClFN3OS/c1-2-20-17(24)22-21-10-12-6-8-13(9-7-12)23-11-14-15(18)4-3-5-16(14)19/h3-10H,2,11H2,1H3,(H2,20,22,24)/b21-10- |
| InChIKey | SMPCGGTXZCJAQG-FBHDLOMBSA-N |
| XLogP | 3.88 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|