C30H29ClFNO4 — CID 68551784
1-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68551784) has the molecular formula C30H29ClFNO4 and a molecular weight of 522.02 g/mol. Its IUPAC name is 1-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68551784 |
| Molecular Formula | C30H29ClFNO4 |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)c1ccc(C=CC(=O)CC(=O)C=Cc2ccc(O)cc2)c(OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C30H29ClFNO4/c1-3-33(4-2)23-13-11-22(30(18-23)37-20-27-28(31)6-5-7-29(27)32)12-17-26(36)19-25(35)16-10-21-8-14-24(34)15-9-21/h5-18,34H,3-4,19-20H2,1-2H3 |
| InChIKey | IDYVOZWUCHPSSJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|