C27H33NO5 — CID 68554626
(1E,6E)-1-[4-(diethylamino)-2-propan-2-yloxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68554626) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is (1E,6E)-1-[4-(diethylamino)-2-propan-2-yloxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-(diethylamino)-2-propan-2-yloxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68554626 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (1E,6E)-1-[4-(diethylamino)-2-propan-2-yloxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)c(OC(C)C)c1 |
| InChI | InChI=1S/C27H33NO5/c1-6-28(7-2)22-12-10-21(26(17-22)33-19(3)4)11-14-24(30)18-23(29)13-8-20-9-15-25(31)27(16-20)32-5/h8-17,19,31H,6-7,18H2,1-5H3/b13-8+,14-11+ |
| InChIKey | ZUHWZEBBXGXAAA-HVUCGZAQSA-N |
| XLogP | 5.29 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|