C24H25NO4 — CID 175142362
9-[4-(dimethylamino)phenyl]-1-(4-hydroxy-3-methoxyphenyl)nona-1,6,8-triene-3,5-dione (PubChem CID 175142362) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-1-(4-hydroxy-3-methoxyphenyl)nona-1,6,8-triene-3,5-dione.
| Compound Name | 9-[4-(dimethylamino)phenyl]-1-(4-hydroxy-3-methoxyphenyl)nona-1,6,8-triene-3,5-dione |
|---|---|
| PubChem CID | 175142362 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-1-(4-hydroxy-3-methoxyphenyl)nona-1,6,8-triene-3,5-dione |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=CC=Cc2ccc(N(C)C)cc2)ccc1O |
| InChI | InChI=1S/C24H25NO4/c1-25(2)20-12-8-18(9-13-20)6-4-5-7-21(26)17-22(27)14-10-19-11-15-23(28)24(16-19)29-3/h4-16,28H,17H2,1-3H3 |
| InChIKey | QPEJRHQUJMGSJI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|