C21H20O10 — CID 87090756
(1E,6E)-1-[2,4-dihydroxy-3-(trihydroxymethoxy)phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 87090756) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is (1E,6E)-1-[2,4-dihydroxy-3-(trihydroxymethoxy)phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[2,4-dihydroxy-3-(trihydroxymethoxy)phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 87090756 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (1E,6E)-1-[2,4-dihydroxy-3-(trihydroxymethoxy)phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC(O)(O)O)c2O)ccc1O |
| InChI | InChI=1S/C21H20O10/c1-30-18-10-12(3-8-16(18)24)2-6-14(22)11-15(23)7-4-13-5-9-17(25)20(19(13)26)31-21(27,28)29/h2-10,24-29H,11H2,1H3/b6-2+,7-4+ |
| InChIKey | RPCZIVGBMPERPP-DDEVBNQJSA-N |
| XLogP | 1.03 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|