C33H47NO6 — CID 174959278
azane;(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-2-propyl-3-(4-propylheptan-4-yloxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 174959278) has the molecular formula C33H47NO6 and a molecular weight of 553.74 g/mol. Its IUPAC name is azane;(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-2-propyl-3-(4-propylheptan-4-yloxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | azane;(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-2-propyl-3-(4-propylheptan-4-yloxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 174959278 |
| Molecular Formula | C33H47NO6 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | azane;(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-2-propyl-3-(4-propylheptan-4-yloxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | CCCc1c(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc(O)c1OC(CCC)(CCC)CCC.N |
| InChI | InChI=1S/C33H44O6.H3N/c1-6-10-28-25(14-18-30(37)32(28)39-33(19-7-2,20-8-3)21-9-4)13-16-27(35)23-26(34)15-11-24-12-17-29(36)31(22-24)38-5;/h11-18,22,36-37H,6-10,19-21,23H2,1-5H3;1H3/b15-11+,16-13+; |
| InChIKey | HUKVUVKXFYEQTH-ORNVFGAXSA-N |
| XLogP | 7.99 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|