C29H35NO5 — CID 68555312
(1E,6E)-1-[4-(diethylamino)-2-(3-methylbut-2-enoxy)phenyl]-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68555312) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is (1E,6E)-1-[4-(diethylamino)-2-(3-methylbut-2-enoxy)phenyl]-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-(diethylamino)-2-(3-methylbut-2-enoxy)phenyl]-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68555312 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (1E,6E)-1-[4-(diethylamino)-2-(3-methylbut-2-enoxy)phenyl]-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC)c(O)c2)c(OCC=C(C)C)c1 |
| InChI | InChI=1S/C29H35NO5/c1-6-30(7-2)24-12-10-23(29(19-24)35-17-16-21(3)4)11-14-26(32)20-25(31)13-8-22-9-15-28(34-5)27(33)18-22/h8-16,18-19,33H,6-7,17,20H2,1-5H3/b13-8+,14-11+ |
| InChIKey | RZBRYIZCGAXVME-HVUCGZAQSA-N |
| XLogP | 5.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|