C25H25NO5 — CID 175337881
7-(diethylamino)-3-[(1E,4E)-5-(3-hydroxy-4-methoxyphenyl)-3-oxopenta-1,4-dienyl]chromen-2-one (PubChem CID 175337881) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is 7-(diethylamino)-3-[(1E,4E)-5-(3-hydroxy-4-methoxyphenyl)-3-oxopenta-1,4-dienyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[(1E,4E)-5-(3-hydroxy-4-methoxyphenyl)-3-oxopenta-1,4-dienyl]chromen-2-one |
|---|---|
| PubChem CID | 175337881 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 7-(diethylamino)-3-[(1E,4E)-5-(3-hydroxy-4-methoxyphenyl)-3-oxopenta-1,4-dienyl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(/C=C/C(=O)/C=C/c3ccc(OC)c(O)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H25NO5/c1-4-26(5-2)20-10-8-18-15-19(25(29)31-24(18)16-20)9-12-21(27)11-6-17-7-13-23(30-3)22(28)14-17/h6-16,28H,4-5H2,1-3H3/b11-6+,12-9+ |
| InChIKey | ZGGVPLYYQXOPNW-MOPWJCKASA-N |
| XLogP | 4.65 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|