C30H35N3O7 — CID 155555746
7-(diethylamino)-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazine-1-carbonyl]chromen-2-one (PubChem CID 155555746) has the molecular formula C30H35N3O7 and a molecular weight of 549.62 g/mol. Its IUPAC name is 7-(diethylamino)-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 155555746 |
| Molecular Formula | C30H35N3O7 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 7-(diethylamino)-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazine-1-carbonyl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C(=O)N3CCN(C(=O)/C=C/c4cc(OC)c(OC)c(OC)c4)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C30H35N3O7/c1-6-31(7-2)22-10-9-21-18-23(30(36)40-24(21)19-22)29(35)33-14-12-32(13-15-33)27(34)11-8-20-16-25(37-3)28(39-5)26(17-20)38-4/h8-11,16-19H,6-7,12-15H2,1-5H3/b11-8+ |
| InChIKey | OHQNYKWHEBNVCB-DHZHZOJOSA-N |
| XLogP | 3.66 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|