C24H35N2O4S+ — CID 170959780
[(1E,3Z,5E)-1-[7-(diethylamino)-2-oxochromen-3-yl]-6-methoxysulfinylhepta-1,3,5-trien-3-yl]-methylazanium;ethane (PubChem CID 170959780) has the molecular formula C24H35N2O4S+ and a molecular weight of 447.62 g/mol. Its IUPAC name is [(1E,3Z,5E)-1-[7-(diethylamino)-2-oxochromen-3-yl]-6-methoxysulfinylhepta-1,3,5-trien-3-yl]-methylazanium;ethane.
| Compound Name | [(1E,3Z,5E)-1-[7-(diethylamino)-2-oxochromen-3-yl]-6-methoxysulfinylhepta-1,3,5-trien-3-yl]-methylazanium;ethane |
|---|---|
| PubChem CID | 170959780 |
| Molecular Formula | C24H35N2O4S+ |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [(1E,3Z,5E)-1-[7-(diethylamino)-2-oxochromen-3-yl]-6-methoxysulfinylhepta-1,3,5-trien-3-yl]-methylazanium;ethane |
| SMILES | CC.CCN(CC)c1ccc2cc(/C=C/C(=C/C=C(\C)S(=O)OC)[NH2+]C)c(=O)oc2c1 |
| InChI | InChI=1S/C22H28N2O4S.C2H6/c1-6-24(7-2)20-13-10-17-14-18(22(25)28-21(17)15-20)9-12-19(23-4)11-8-16(3)29(26)27-5;1-2/h8-15,23H,6-7H2,1-5H3;1-2H3/p+1/b12-9+,16-8+,19-11-; |
| InChIKey | OZZSHKWICHDUPG-FHCXRHQNSA-O |
| XLogP | 3.97 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|