C24H28FNO5 — CID 70248081
2-[5-[(Z)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2-[1-(4-fluorophenyl)ethoxy]phenoxy]acetic acid (PubChem CID 70248081) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[5-[(Z)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2-[1-(4-fluorophenyl)ethoxy]phenoxy]acetic acid.
| Compound Name | 2-[5-[(Z)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2-[1-(4-fluorophenyl)ethoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70248081 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2-[5-[(Z)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2-[1-(4-fluorophenyl)ethoxy]phenoxy]acetic acid |
| SMILES | CCN(CC)C(=O)/C=C(/C)c1ccc(OC(C)c2ccc(F)cc2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C24H28FNO5/c1-5-26(6-2)23(27)13-16(3)19-9-12-21(22(14-19)30-15-24(28)29)31-17(4)18-7-10-20(25)11-8-18/h7-14,17H,5-6,15H2,1-4H3,(H,28,29)/b16-13- |
| InChIKey | DHJFXNZJOXDCDK-SSZFMOIBSA-N |
| XLogP | 4.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|