C12H10F4O4 — CID 66604449
3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid (PubChem CID 66604449) has the molecular formula C12H10F4O4 and a molecular weight of 294.20 g/mol. Its IUPAC name is 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid.
| Compound Name | 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 66604449 |
| Molecular Formula | C12H10F4O4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)c1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H10F4O4/c1-6(4-10(17)18)7-2-3-8(19-11(13)14)9(5-7)20-12(15)16/h2-5,11-12H,1H3,(H,17,18) |
| InChIKey | LQKMUMZLJHXTJF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|