3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid

C12H10F4O4 — CID 66604449

IUPAC3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid
SMILESCC(=CC(=O)O)c1ccc(OC(F)F)c(OC(F)F)c1
InChIInChI=1S/C12H10F4O4/c1-6(4-10(17)18)7-2-3-8(19-11(13)14)9(5-7)20-12(15)16/h2-5,11-12H,1H3,(H,17,18)
InChIKeyLQKMUMZLJHXTJF-UHFFFAOYSA-N
MW294.20 g/mol
LogP3.38
Rot. Bonds6

About 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid

3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid (PubChem CID 66604449) has the molecular formula C12H10F4O4 and a molecular weight of 294.20 g/mol. Its IUPAC name is 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid.

Molecular Properties

Compound Name3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid
PubChem CID66604449
Molecular FormulaC12H10F4O4
Molecular Weight294.20 g/mol
Exact Mass294.05
IUPAC Name3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid
SMILESCC(=CC(=O)O)c1ccc(OC(F)F)c(OC(F)F)c1
InChIInChI=1S/C12H10F4O4/c1-6(4-10(17)18)7-2-3-8(19-11(13)14)9(5-7)20-12(15)16/h2-5,11-12H,1H3,(H,17,18)
InChIKeyLQKMUMZLJHXTJF-UHFFFAOYSA-N
XLogP3.38
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.20
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid?
The IUPAC name of 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid (CID 66604449) is 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid.
What is the SMILES notation for 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid?
The canonical SMILES for 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid is CC(=CC(=O)O)c1ccc(OC(F)F)c(OC(F)F)c1.
What is the InChIKey of 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid?
The InChIKey is LQKMUMZLJHXTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F4O4/c1-6(4-10(17)18)7-2-3-8(19-11(13)14)9(5-7)20-12(15)16/h2-5,11-12H,1H3,(H,17,18).
What are the key properties of 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid?
3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid has a molecular weight of 294.20 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-bis(difluoromethoxy)phenyl]but-2-enoic acid is sourced from PubChem (CID 66604449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).