C34H32ClNO10S2 — CID 70198153
2-[4-chloro-2,5-bis(methylsulfanyl)phenoxy]acetic acid;2-(4-hydroxyphenyl)-2-phenylacetic acid;(E)-3-(3-nitrophenyl)but-2-enoic acid (PubChem CID 70198153) has the molecular formula C34H32ClNO10S2 and a molecular weight of 714.21 g/mol. Its IUPAC name is 2-[4-chloro-2,5-bis(methylsulfanyl)phenoxy]acetic acid;2-(4-hydroxyphenyl)-2-phenylacetic acid;(E)-3-(3-nitrophenyl)but-2-enoic acid.
| Compound Name | 2-[4-chloro-2,5-bis(methylsulfanyl)phenoxy]acetic acid;2-(4-hydroxyphenyl)-2-phenylacetic acid;(E)-3-(3-nitrophenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 70198153 |
| Molecular Formula | C34H32ClNO10S2 |
| Molecular Weight | 714.21 g/mol |
| Exact Mass | 713.12 |
| IUPAC Name | 2-[4-chloro-2,5-bis(methylsulfanyl)phenoxy]acetic acid;2-(4-hydroxyphenyl)-2-phenylacetic acid;(E)-3-(3-nitrophenyl)but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1cccc([N+](=O)[O-])c1.CSc1cc(OCC(=O)O)c(SC)cc1Cl.O=C(O)C(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H12O3.C10H11ClO3S2.C10H9NO4/c15-12-8-6-11(7-9-12)13(14(16)17)10-4-2-1-3-5-10;1-15-8-4-7(14-5-10(12)13)9(16-2)3-6(8)11;1-7(5-10(12)13)8-3-2-4-9(6-8)11(14)15/h1-9,13,15H,(H,16,17);3-4H,5H2,1-2H3,(H,12,13);2-6H,1H3,(H,12,13)/b;;7-5+ |
| InChIKey | STIUIUGFYXFUGY-AWHULUMYSA-N |
| XLogP | 7.94 |
| TPSA | 184.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.21 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|