C31H32N2O4 — CID 10368575
4-[2-[methyl-[(E)-3-[1-(1-phenylethyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 10368575) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[2-[methyl-[(E)-3-[1-(1-phenylethyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[methyl-[(E)-3-[1-(1-phenylethyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10368575 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 4-[2-[methyl-[(E)-3-[1-(1-phenylethyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | C/C(=C\C(=O)N(C)c1ccccc1OCCCC(=O)O)c1ccc2c(ccn2C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C31H32N2O4/c1-22(20-30(34)32(3)28-12-7-8-13-29(28)37-19-9-14-31(35)36)25-15-16-27-26(21-25)17-18-33(27)23(2)24-10-5-4-6-11-24/h4-8,10-13,15-18,20-21,23H,9,14,19H2,1-3H3,(H,35,36)/b22-20+ |
| InChIKey | RXVQBOALWQNEDW-LSDHQDQOSA-N |
| XLogP | 6.56 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|