C26H23NO2 — CID 19742033
(E)-3-[1-[(3-methylphenyl)-phenylmethyl]indol-5-yl]but-2-enoic acid (PubChem CID 19742033) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (E)-3-[1-[(3-methylphenyl)-phenylmethyl]indol-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-[1-[(3-methylphenyl)-phenylmethyl]indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 19742033 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (E)-3-[1-[(3-methylphenyl)-phenylmethyl]indol-5-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1ccc2c(ccn2C(c2ccccc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C26H23NO2/c1-18-7-6-10-23(15-18)26(20-8-4-3-5-9-20)27-14-13-22-17-21(11-12-24(22)27)19(2)16-25(28)29/h3-17,26H,1-2H3,(H,28,29)/b19-16+ |
| InChIKey | PONAEXBISXMBNN-KNTRCKAVSA-N |
| XLogP | 6.08 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|