C22H21NO2 — CID 54558779
3-[1-(1,2,3,4-tetrahydronaphthalen-1-yl)indol-5-yl]but-2-enoic acid (PubChem CID 54558779) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[1-(1,2,3,4-tetrahydronaphthalen-1-yl)indol-5-yl]but-2-enoic acid.
| Compound Name | 3-[1-(1,2,3,4-tetrahydronaphthalen-1-yl)indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 54558779 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[1-(1,2,3,4-tetrahydronaphthalen-1-yl)indol-5-yl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)c1ccc2c(ccn2C2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C22H21NO2/c1-15(13-22(24)25)17-9-10-20-18(14-17)11-12-23(20)21-8-4-6-16-5-2-3-7-19(16)21/h2-3,5,7,9-14,21H,4,6,8H2,1H3,(H,24,25) |
| InChIKey | ZPBFDEYIKRRTDJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|