C18H19NO — CID 3756805
N-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 3756805) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is N-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | N-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 3756805 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CC(=O)N(c1ccccc1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C18H19NO/c1-14(20)19(16-10-3-2-4-11-16)18-13-7-9-15-8-5-6-12-17(15)18/h2-6,8,10-12,18H,7,9,13H2,1H3 |
| InChIKey | IAXRXHBBQMGCMR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |