C11H13NO3 — CID 87438864
2,3-dihydro-1H-inden-1-yl(methoxy)carbamic acid (PubChem CID 87438864) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl(methoxy)carbamic acid.
| Compound Name | 2,3-dihydro-1H-inden-1-yl(methoxy)carbamic acid |
|---|---|
| PubChem CID | 87438864 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl(methoxy)carbamic acid |
| SMILES | CON(C(=O)O)C1CCc2ccccc21 |
| InChI | InChI=1S/C11H13NO3/c1-15-12(11(13)14)10-7-6-8-4-2-3-5-9(8)10/h2-5,10H,6-7H2,1H3,(H,13,14) |
| InChIKey | QSIYLSKWGXOPSF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|